C25H33ClN8O2 — CID 118933337
2-[4-[3-[4-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperazin-1-yl]phenyl]-6-chloroquinazolin-2-yl]guanidine (PubChem CID 118933337) has the molecular formula C25H33ClN8O2 and a molecular weight of 513.05 g/mol. Its IUPAC name is 2-[4-[3-[4-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperazin-1-yl]phenyl]-6-chloroquinazolin-2-yl]guanidine.
| Compound Name | 2-[4-[3-[4-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperazin-1-yl]phenyl]-6-chloroquinazolin-2-yl]guanidine |
|---|---|
| PubChem CID | 118933337 |
| Molecular Formula | C25H33ClN8O2 |
| Molecular Weight | 513.05 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 2-[4-[3-[4-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperazin-1-yl]phenyl]-6-chloroquinazolin-2-yl]guanidine |
| SMILES | NCCOCCOCCN1CCN(c2cccc(-c3nc(N=C(N)N)nc4ccc(Cl)cc34)c2)CC1 |
| InChI | InChI=1S/C25H33ClN8O2/c26-19-4-5-22-21(17-19)23(31-25(30-22)32-24(28)29)18-2-1-3-20(16-18)34-9-7-33(8-10-34)11-13-36-15-14-35-12-6-27/h1-5,16-17H,6-15,27H2,(H4,28,29,30,31,32) |
| InChIKey | MEADUKCDSOMGAV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.05 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|