C17H19F3N4O4 — CID 118933630
[(4S,5S)-5-azido-4,6-dimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 118933630) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is [(4S,5S)-5-azido-4,6-dimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(4S,5S)-5-azido-4,6-dimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 118933630 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [(4S,5S)-5-azido-4,6-dimethyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(O/C(=N/c2ccccc2)C(F)(F)F)OC(C)[C@@H](N=[N+]=[N-])[C@@H]1C |
| InChI | InChI=1S/C17H19F3N4O4/c1-9-13(23-24-21)10(2)26-15(14(9)27-11(3)25)28-16(17(18,19)20)22-12-7-5-4-6-8-12/h4-10,13-15H,1-3H3/b22-16+/t9-,10?,13-,14?,15?/m0/s1 |
| InChIKey | NSNMRXLNKMPVGB-ZKAVDLJXSA-N |
| XLogP | 4.29 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|