C6H4F7NO2 — CID 118933717
N-acetyl-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 118933717) has the molecular formula C6H4F7NO2 and a molecular weight of 255.09 g/mol. Its IUPAC name is N-acetyl-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-acetyl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 118933717 |
| Molecular Formula | C6H4F7NO2 |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | N-acetyl-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CC(=O)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F7NO2/c1-2(15)14-3(16)4(7,8)5(9,10)6(11,12)13/h1H3,(H,14,15,16) |
| InChIKey | XJVIEBMWEHFPIE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|