C25H26F2N4O7 — CID 118933908
(4R,5R,6R)-5-acetamido-4-(4,5-diphenyltriazol-1-yl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 118933908) has the molecular formula C25H26F2N4O7 and a molecular weight of 532.50 g/mol. Its IUPAC name is (4R,5R,6R)-5-acetamido-4-(4,5-diphenyltriazol-1-yl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (4R,5R,6R)-5-acetamido-4-(4,5-diphenyltriazol-1-yl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118933908 |
| Molecular Formula | C25H26F2N4O7 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | (4R,5R,6R)-5-acetamido-4-(4,5-diphenyltriazol-1-yl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(F)(C(=O)O)C(F)[C@@H]1n1nnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H26F2N4O7/c1-13(33)28-18-20(23(26)25(27,24(36)37)38-22(18)21(35)16(34)12-32)31-19(15-10-6-3-7-11-15)17(29-30-31)14-8-4-2-5-9-14/h2-11,16,18,20-23,32,34-35H,12H2,1H3,(H,28,33)(H,36,37)/t16-,18-,20-,21-,22-,23?,25?/m1/s1 |
| InChIKey | JDMMFWJFJVXDTE-PFYCAXNYSA-N |
| XLogP | 0.86 |
| TPSA | 167.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |