About 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene
2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene (PubChem CID 118934139) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene.
Molecular Properties
| Compound Name | 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene |
| PubChem CID | 118934139 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene |
| SMILES | CC12C=CC=CC1C1CCC2O1 |
| InChI | InChI=1S/C11H14O/c1-11-7-3-2-4-8(11)9-5-6-10(11)12-9/h2-4,7-10H,5-6H2,1H3 |
| InChIKey | YGSIMRKGHUHORC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
The IUPAC name of 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene (CID 118934139) is 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene.
What is the SMILES notation for 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
The canonical SMILES for 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene is CC12C=CC=CC1C1CCC2O1.
What is the InChIKey of 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
The InChIKey is YGSIMRKGHUHORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-11-7-3-2-4-8(11)9-5-6-10(11)12-9/h2-4,7-10H,5-6H2,1H3.
What are the key properties of 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene has a molecular weight of 162.23 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene is sourced from PubChem (CID 118934139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).