C20H24F2N2O2 — CID 118934334
(2S)-2-[[(E)-3-cyclopentylprop-2-enoyl]amino]-3-(3,5-difluorophenyl)-N-prop-2-enylpropanamide (PubChem CID 118934334) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-cyclopentylprop-2-enoyl]amino]-3-(3,5-difluorophenyl)-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-cyclopentylprop-2-enoyl]amino]-3-(3,5-difluorophenyl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 118934334 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (2S)-2-[[(E)-3-cyclopentylprop-2-enoyl]amino]-3-(3,5-difluorophenyl)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)/C=C/C1CCCC1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-2-9-23-20(26)18(12-15-10-16(21)13-17(22)11-15)24-19(25)8-7-14-5-3-4-6-14/h2,7-8,10-11,13-14,18H,1,3-6,9,12H2,(H,23,26)(H,24,25)/b8-7+/t18-/m0/s1 |
| InChIKey | AIQXKQLOUPTWAH-DVBCCOPCSA-N |
| XLogP | 3.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|