About 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one
3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one (PubChem CID 118934643) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one |
| PubChem CID | 118934643 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one |
| SMILES | CCN(C)C1=C(O)C(=O)C(C)(O)C1 |
| InChI | InChI=1S/C9H15NO3/c1-4-10(3)6-5-9(2,13)8(12)7(6)11/h11,13H,4-5H2,1-3H3 |
| InChIKey | QDIKNCYLJBBCGJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one?
The IUPAC name of 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one (CID 118934643) is 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one.
What is the SMILES notation for 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one?
The canonical SMILES for 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one is CCN(C)C1=C(O)C(=O)C(C)(O)C1.
What is the InChIKey of 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one?
The InChIKey is QDIKNCYLJBBCGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-4-10(3)6-5-9(2,13)8(12)7(6)11/h11,13H,4-5H2,1-3H3.
What are the key properties of 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one?
3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one has a molecular weight of 185.22 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(methyl)amino]-2,5-dihydroxy-5-methylcyclopent-2-en-1-one is sourced from PubChem (CID 118934643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).