C19H22ClN3O2 — CID 118934801
2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxybutyl]pyridine-4-carboxamide (PubChem CID 118934801) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxybutyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxybutyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118934801 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxybutyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCC(O)CN1CCc2ccccc2C1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c20-18-11-15(5-8-21-18)19(25)22-9-6-17(24)13-23-10-7-14-3-1-2-4-16(14)12-23/h1-5,8,11,17,24H,6-7,9-10,12-13H2,(H,22,25) |
| InChIKey | CLPSNBRUFIBSJT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|