About 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine
1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine (PubChem CID 118936316) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine |
| PubChem CID | 118936316 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine |
| SMILES | NC1C=CC(N)(C2CCOCC2)C=C1 |
| InChI | InChI=1S/C11H18N2O/c12-10-1-5-11(13,6-2-10)9-3-7-14-8-4-9/h1-2,5-6,9-10H,3-4,7-8,12-13H2 |
| InChIKey | LQZRQVATIOUNTK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine?
The IUPAC name of 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine (CID 118936316) is 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine.
What is the SMILES notation for 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine?
The canonical SMILES for 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine is NC1C=CC(N)(C2CCOCC2)C=C1.
What is the InChIKey of 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine?
The InChIKey is LQZRQVATIOUNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c12-10-1-5-11(13,6-2-10)9-3-7-14-8-4-9/h1-2,5-6,9-10H,3-4,7-8,12-13H2.
What are the key properties of 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine?
1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine has a molecular weight of 194.28 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)cyclohexa-2,5-diene-1,4-diamine is sourced from PubChem (CID 118936316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).