C19H25ClN4OS — CID 11893656
2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11893656) has the molecular formula C19H25ClN4OS and a molecular weight of 392.96 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11893656 |
| Molecular Formula | C19H25ClN4OS |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C19H25ClN4OS/c1-12-5-4-6-16(13(12)2)21-17(25)11-26-19-23-22-18(24(19)3)14-7-9-15(20)10-8-14/h7-10,12-13,16H,4-6,11H2,1-3H3,(H,21,25)/t12-,13+,16+/m0/s1 |
| InChIKey | YLZJGRAEIOZXIE-WOSRLPQWSA-N |
| XLogP | 4.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |