C20H15F2N5OS — CID 118936806
(15R)-5-[(2,6-difluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 118936806) has the molecular formula C20H15F2N5OS and a molecular weight of 411.44 g/mol. Its IUPAC name is (15R)-5-[(2,6-difluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-5-[(2,6-difluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 118936806 |
| Molecular Formula | C20H15F2N5OS |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (15R)-5-[(2,6-difluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C[C@@H]1CNc2c(sc3ccc4nc(Nc5cc(F)nc(F)c5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C20H15F2N5OS/c1-9-8-23-18-17-11-2-5-16(25-10-6-14(21)27-15(22)7-10)26-12(11)3-4-13(17)29-19(18)20(28)24-9/h2-7,9,23H,8H2,1H3,(H,24,28)(H,25,26,27)/t9-/m1/s1 |
| InChIKey | DXTNKQUELUESFQ-SECBINFHSA-N |
| XLogP | 4.41 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|