C20H16FN5OS — CID 118936817
(15R)-5-[(2-fluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 118936817) has the molecular formula C20H16FN5OS and a molecular weight of 393.45 g/mol. Its IUPAC name is (15R)-5-[(2-fluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-5-[(2-fluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 118936817 |
| Molecular Formula | C20H16FN5OS |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (15R)-5-[(2-fluoro-4-pyridinyl)amino]-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C[C@@H]1CNc2c(sc3ccc4nc(Nc5ccnc(F)c5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C20H16FN5OS/c1-10-9-23-18-17-12-2-5-16(25-11-6-7-22-15(21)8-11)26-13(12)3-4-14(17)28-19(18)20(27)24-10/h2-8,10,23H,9H2,1H3,(H,24,27)(H,22,25,26)/t10-/m1/s1 |
| InChIKey | YRLDBRWCJYDVKP-SNVBAGLBSA-N |
| XLogP | 4.27 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|