About ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate
ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate (PubChem CID 118937148) has the molecular formula C28H24FN3O3
and a molecular weight of 469.52 g/mol. Its IUPAC name is ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate.
Molecular Properties
| Compound Name | ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate |
| PubChem CID | 118937148 |
| Molecular Formula | C28H24FN3O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate |
| SMILES | CCOC(=O)c1ccc(-n2nc(Cc3ccccc3)c3cc(-c4c(C)noc4C)ccc32)c(F)c1 |
| InChI | InChI=1S/C28H24FN3O3/c1-4-34-28(33)21-11-13-26(23(29)16-21)32-25-12-10-20(27-17(2)31-35-18(27)3)15-22(25)24(30-32)14-19-8-6-5-7-9-19/h5-13,15-16H,4,14H2,1-3H3 |
| InChIKey | IQNUHYFCVNLJGB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate?
The IUPAC name of ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate (CID 118937148) is ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate.
What is the SMILES notation for ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate?
The canonical SMILES for ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate is CCOC(=O)c1ccc(-n2nc(Cc3ccccc3)c3cc(-c4c(C)noc4C)ccc32)c(F)c1.
What is the InChIKey of ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate?
The InChIKey is IQNUHYFCVNLJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24FN3O3/c1-4-34-28(33)21-11-13-26(23(29)16-21)32-25-12-10-20(27-17(2)31-35-18(27)3)15-22(25)24(30-32)14-19-8-6-5-7-9-19/h5-13,15-16H,4,14H2,1-3H3.
What are the key properties of ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate?
ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate has a molecular weight of 469.52 g/mol, XLogP of 6.20, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)indazol-1-yl]-3-fluorobenzoate is sourced from PubChem (CID 118937148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).