About 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane
2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane (PubChem CID 118937461) has the molecular formula C6H10F4O2
and a molecular weight of 190.14 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane |
| PubChem CID | 118937461 |
| Molecular Formula | C6H10F4O2 |
| Molecular Weight | 190.14 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane |
| SMILES | FC(F)COCCOCC(F)F |
| InChI | InChI=1S/C6H10F4O2/c7-5(8)3-11-1-2-12-4-6(9)10/h5-6H,1-4H2 |
| InChIKey | KLOWBILJKLNSMB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane (CID 118937461) is 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane is FC(F)COCCOCC(F)F.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane?
The InChIKey is KLOWBILJKLNSMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F4O2/c7-5(8)3-11-1-2-12-4-6(9)10/h5-6H,1-4H2.
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane?
2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane has a molecular weight of 190.14 g/mol, XLogP of 1.55, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethoxy]-1,1-difluoroethane is sourced from PubChem (CID 118937461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).