C38H42F4N4O2 — CID 118938900
1,2-bis[4-fluoro-4-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]ethane-1,2-diol (PubChem CID 118938900) has the molecular formula C38H42F4N4O2 and a molecular weight of 662.77 g/mol. Its IUPAC name is 1,2-bis[4-fluoro-4-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]ethane-1,2-diol.
| Compound Name | 1,2-bis[4-fluoro-4-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 118938900 |
| Molecular Formula | C38H42F4N4O2 |
| Molecular Weight | 662.77 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | 1,2-bis[4-fluoro-4-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]ethane-1,2-diol |
| SMILES | OC(C1CCC(F)(CCC2c3c(F)cccc3-c3cncn32)CC1)C(O)C1CCC(F)(CCC2c3c(F)cccc3-c3cncn32)CC1 |
| InChI | InChI=1S/C38H42F4N4O2/c39-27-5-1-3-25-31-19-43-21-45(31)29(33(25)27)11-17-37(41)13-7-23(8-14-37)35(47)36(48)24-9-15-38(42,16-10-24)18-12-30-34-26(4-2-6-28(34)40)32-20-44-22-46(30)32/h1-6,19-24,29-30,35-36,47-48H,7-18H2 |
| InChIKey | SMTDCDZOHJWNGE-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.77 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |