C22H27N2O3+ — CID 11893906
1-[(3S,10bR)-3-(3-ethoxy-4-methoxyphenyl)-1,3,4,5,6,10b-hexahydroimidazo[5,1-a]isoquinolin-4-ium-2-yl]ethanone (PubChem CID 11893906) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[(3S,10bR)-3-(3-ethoxy-4-methoxyphenyl)-1,3,4,5,6,10b-hexahydroimidazo[5,1-a]isoquinolin-4-ium-2-yl]ethanone.
| Compound Name | 1-[(3S,10bR)-3-(3-ethoxy-4-methoxyphenyl)-1,3,4,5,6,10b-hexahydroimidazo[5,1-a]isoquinolin-4-ium-2-yl]ethanone |
|---|---|
| PubChem CID | 11893906 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1-[(3S,10bR)-3-(3-ethoxy-4-methoxyphenyl)-1,3,4,5,6,10b-hexahydroimidazo[5,1-a]isoquinolin-4-ium-2-yl]ethanone |
| SMILES | CCOc1cc([C@H]2N(C(C)=O)C[C@H]3c4ccccc4CC[NH+]32)ccc1OC |
| InChI | InChI=1S/C22H26N2O3/c1-4-27-21-13-17(9-10-20(21)26-3)22-23-12-11-16-7-5-6-8-18(16)19(23)14-24(22)15(2)25/h5-10,13,19,22H,4,11-12,14H2,1-3H3/p+1/t19-,22+/m0/s1 |
| InChIKey | HQKMUKHHTVHRRJ-SIKLNZKXSA-O |
| XLogP | 2.14 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |