About 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one
2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one (PubChem CID 118939921) has the molecular formula C14H15ClN2O3
and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one.
Molecular Properties
| Compound Name | 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one |
| PubChem CID | 118939921 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one |
| SMILES | O=C1OC2(CCN(C3COC3)CC2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C14H15ClN2O3/c15-11-2-1-10-12(16-11)14(20-13(10)18)3-5-17(6-4-14)9-7-19-8-9/h1-2,9H,3-8H2 |
| InChIKey | DVYSKYIJIKCXDW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one?
The IUPAC name of 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one (CID 118939921) is 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one.
What is the SMILES notation for 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one?
The canonical SMILES for 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one is O=C1OC2(CCN(C3COC3)CC2)c2nc(Cl)ccc21.
What is the InChIKey of 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one?
The InChIKey is DVYSKYIJIKCXDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O3/c15-11-2-1-10-12(16-11)14(20-13(10)18)3-5-17(6-4-14)9-7-19-8-9/h1-2,9H,3-8H2.
What are the key properties of 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one?
2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one has a molecular weight of 294.74 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1'-(oxetan-3-yl)spiro[furo[3,4-b]pyridine-7,4'-piperidine]-5-one is sourced from PubChem (CID 118939921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).