About methyl 2-bromobenzoate
methyl 2-bromobenzoate (PubChem CID 11894) has the molecular formula C8H7BrO2
and a molecular weight of 215.05 g/mol. Its IUPAC name is methyl 2-bromobenzoate.
Molecular Properties
| Compound Name | methyl 2-bromobenzoate |
| PubChem CID | 11894 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | methyl 2-bromobenzoate |
| SMILES | COC(=O)c1ccccc1Br |
| InChI | InChI=1S/C8H7BrO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| InChIKey | SWGQITQOBPXVRC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromobenzoate?
The IUPAC name of methyl 2-bromobenzoate (CID 11894) is methyl 2-bromobenzoate.
What is the SMILES notation for methyl 2-bromobenzoate?
The canonical SMILES for methyl 2-bromobenzoate is COC(=O)c1ccccc1Br.
What is the InChIKey of methyl 2-bromobenzoate?
The InChIKey is SWGQITQOBPXVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3.
What are the key properties of methyl 2-bromobenzoate?
methyl 2-bromobenzoate has a molecular weight of 215.05 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromobenzoate is sourced from PubChem (CID 11894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).