About N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide
N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide (PubChem CID 118940328) has the molecular formula C21H25BrN2O
and a molecular weight of 401.35 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide.
Molecular Properties
| Compound Name | N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide |
| PubChem CID | 118940328 |
| Molecular Formula | C21H25BrN2O |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide |
| SMILES | CCC(=O)N[C@@H](C)c1ccc(CN2CCc3c(Br)cccc3C2)cc1 |
| InChI | InChI=1S/C21H25BrN2O/c1-3-21(25)23-15(2)17-9-7-16(8-10-17)13-24-12-11-19-18(14-24)5-4-6-20(19)22/h4-10,15H,3,11-14H2,1-2H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | UMFLBFPVWJXLKD-HNNXBMFYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide?
The IUPAC name of N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide (CID 118940328) is N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide.
What is the SMILES notation for N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide?
The canonical SMILES for N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide is CCC(=O)N[C@@H](C)c1ccc(CN2CCc3c(Br)cccc3C2)cc1.
What is the InChIKey of N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide?
The InChIKey is UMFLBFPVWJXLKD-HNNXBMFYSA-N. The full InChI is InChI=1S/C21H25BrN2O/c1-3-21(25)23-15(2)17-9-7-16(8-10-17)13-24-12-11-19-18(14-24)5-4-6-20(19)22/h4-10,15H,3,11-14H2,1-2H3,(H,23,25)/t15-/m0/s1.
What are the key properties of N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide?
N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide has a molecular weight of 401.35 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-[4-[(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]ethyl]propanamide is sourced from PubChem (CID 118940328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).