C7H10O — CID 118940455
1,1,1-trideuterio-2-(1,2,2,3,3-pentadeuteriocyclopropyl)but-3-yn-2-ol (PubChem CID 118940455) has the molecular formula C7H10O and a molecular weight of 118.20 g/mol. Its IUPAC name is 1,1,1-trideuterio-2-(1,2,2,3,3-pentadeuteriocyclopropyl)but-3-yn-2-ol.
| Compound Name | 1,1,1-trideuterio-2-(1,2,2,3,3-pentadeuteriocyclopropyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 118940455 |
| Molecular Formula | C7H10O |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | 1,1,1-trideuterio-2-(1,2,2,3,3-pentadeuteriocyclopropyl)but-3-yn-2-ol |
| SMILES | [2H]C([2H])([2H])C(O)(C#C)C1([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C7H10O/c1-3-7(2,8)6-4-5-6/h1,6,8H,4-5H2,2H3/i2D3,4D2,5D2,6D |
| InChIKey | TXBLNDNWPNEHKV-UVFCLWCGSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|