About 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one
6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one (PubChem CID 118941367) has the molecular formula C11H11ClN2O2
and a molecular weight of 238.67 g/mol. Its IUPAC name is 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one.
Molecular Properties
| Compound Name | 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one |
| PubChem CID | 118941367 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one |
| SMILES | CN1CCC2(C1)OC(=O)c1cnc(Cl)cc12 |
| InChI | InChI=1S/C11H11ClN2O2/c1-14-3-2-11(6-14)8-4-9(12)13-5-7(8)10(15)16-11/h4-5H,2-3,6H2,1H3 |
| InChIKey | KCADRPAJPHDVID-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one?
The IUPAC name of 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one (CID 118941367) is 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one.
What is the SMILES notation for 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one?
The canonical SMILES for 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one is CN1CCC2(C1)OC(=O)c1cnc(Cl)cc12.
What is the InChIKey of 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one?
The InChIKey is KCADRPAJPHDVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O2/c1-14-3-2-11(6-14)8-4-9(12)13-5-7(8)10(15)16-11/h4-5H,2-3,6H2,1H3.
What are the key properties of 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one?
6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one has a molecular weight of 238.67 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1'-methylspiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one is sourced from PubChem (CID 118941367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).