About N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine
N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 1189431) has the molecular formula C20H17N3O2S
and a molecular weight of 363.44 g/mol. Its IUPAC name is N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 1189431 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ncnc3scc(-c4ccc(OC)cc4)c23)cc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-24-15-7-3-13(4-8-15)17-11-26-20-18(17)19(21-12-22-20)23-14-5-9-16(25-2)10-6-14/h3-12H,1-2H3,(H,21,22,23) |
| InChIKey | IBLVRWXMJGVKAV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (CID 1189431) is N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine is COc1ccc(Nc2ncnc3scc(-c4ccc(OC)cc4)c23)cc1.
What is the InChIKey of N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is IBLVRWXMJGVKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2S/c1-24-15-7-3-13(4-8-15)17-11-26-20-18(17)19(21-12-22-20)23-14-5-9-16(25-2)10-6-14/h3-12H,1-2H3,(H,21,22,23).
What are the key properties of N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 363.44 g/mol, XLogP of 5.12, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-bis(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 1189431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).