C17H23NO — CID 118943956
4-methyl-4-azahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecan-5-one (PubChem CID 118943956) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-methyl-4-azahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecan-5-one.
| Compound Name | 4-methyl-4-azahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecan-5-one |
|---|---|
| PubChem CID | 118943956 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4-methyl-4-azahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecan-5-one |
| SMILES | CN1C(=O)C2CC1C1C3CC(C4C5CCC(C5)C34)C21 |
| InChI | InChI=1S/C17H23NO/c1-18-12-6-11(17(18)19)15-9-5-10(16(12)15)14-8-3-2-7(4-8)13(9)14/h7-16H,2-6H2,1H3 |
| InChIKey | ZSKWLVIZKJQFQJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|