About 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one
8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one (PubChem CID 118943962) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one.
Molecular Properties
| Compound Name | 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one |
| PubChem CID | 118943962 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one |
| SMILES | CN1C(=O)C2CC1C1CCCC21 |
| InChI | InChI=1S/C10H15NO/c1-11-9-5-8(10(11)12)6-3-2-4-7(6)9/h6-9H,2-5H2,1H3 |
| InChIKey | NQWFZUJOOZLHOW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one?
The IUPAC name of 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one (CID 118943962) is 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one.
What is the SMILES notation for 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one?
The canonical SMILES for 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one is CN1C(=O)C2CC1C1CCCC21.
What is the InChIKey of 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one?
The InChIKey is NQWFZUJOOZLHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-11-9-5-8(10(11)12)6-3-2-4-7(6)9/h6-9H,2-5H2,1H3.
What are the key properties of 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one?
8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one has a molecular weight of 165.24 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-8-azatricyclo[5.2.1.02,6]decan-9-one is sourced from PubChem (CID 118943962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).