C24H22N2 — CID 118944080
2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylphenyl]imidazole (PubChem CID 118944080) has the molecular formula C24H22N2 and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylphenyl]imidazole.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylphenyl]imidazole |
|---|---|
| PubChem CID | 118944080 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(2,3,4,5,6-pentadeuteriophenyl)-6-propan-2-ylphenyl]imidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(C(C)C)c2-n2ccnc2-c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C24H22N2/c1-18(2)21-14-9-15-22(19-10-5-3-6-11-19)23(21)26-17-16-25-24(26)20-12-7-4-8-13-20/h3-18H,1-2H3/i3D,4D,5D,6D,7D,8D,10D,11D,12D,13D |
| InChIKey | PANQMIHMFBPNFX-ZKZWDRQZSA-N |
| XLogP | 6.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |