About CID 118944099
CID 118944099 (PubChem CID 118944099) has the molecular formula C2H3I2S3-
and a molecular weight of 377.06 g/mol.
Molecular Properties
| Compound Name | CID 118944099 |
| PubChem CID | 118944099 |
| Molecular Formula | C2H3I2S3- |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 376.75 |
| IUPAC Name | — |
| SMILES | S=[S-](=S)CC(I)I |
| InChI | InChI=1S/C2H3I2S3/c3-2(4)1-7(5)6/h2H,1H2/q-1 |
| InChIKey | HPLZNBBETDZJHM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 118944099 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118944099?
The IUPAC name of CID 118944099 (CID 118944099) is not available.
What is the SMILES notation for CID 118944099?
The canonical SMILES for CID 118944099 is S=[S-](=S)CC(I)I.
What is the InChIKey of CID 118944099?
The InChIKey is HPLZNBBETDZJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3I2S3/c3-2(4)1-7(5)6/h2H,1H2/q-1.
What are the key properties of CID 118944099?
CID 118944099 has a molecular weight of 377.06 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118944099 is sourced from PubChem (CID 118944099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).