C19H24N5O5+ — CID 11894428
(4aS,5R)-3-methyl-8-nitro-1'-propylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 11894428) has the molecular formula C19H24N5O5+ and a molecular weight of 402.43 g/mol. Its IUPAC name is (4aS,5R)-3-methyl-8-nitro-1'-propylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aS,5R)-3-methyl-8-nitro-1'-propylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 11894428 |
| Molecular Formula | C19H24N5O5+ |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (4aS,5R)-3-methyl-8-nitro-1'-propylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | CCCN1C(=O)NC(=O)[C@]2(Cc3cc([N+](=O)[O-])ccc3N3CC[NH+](C)C[C@@H]32)C1=O |
| InChI | InChI=1S/C19H23N5O5/c1-3-6-23-17(26)19(16(25)20-18(23)27)10-12-9-13(24(28)29)4-5-14(12)22-8-7-21(2)11-15(19)22/h4-5,9,15H,3,6-8,10-11H2,1-2H3,(H,20,25,27)/p+1/t15-,19-/m1/s1 |
| InChIKey | LKOYTYUHBYDIHR-DNVCBOLYSA-O |
| XLogP | -0.67 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|