C14H18ClN3OS — CID 118944463
N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N,2-dimethylpropanamide (PubChem CID 118944463) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N,2-dimethylpropanamide.
| Compound Name | N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 118944463 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N,2-dimethylpropanamide |
| SMILES | [H]/N=C/C(=C\C=C/C)c1nc(Cl)c(N(C)C(=O)C(C)C)s1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-5-6-7-10(8-16)12-17-11(15)14(20-12)18(4)13(19)9(2)3/h5-9,16H,1-4H3/b6-5-,10-7+,16-8+ |
| InChIKey | KFCMDKVNHTVCRP-OWEXCGSJSA-N |
| XLogP | 4.02 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|