C14H14F3N3O2S — CID 118944669
4-methoxy-2-pyridin-3-yl-N-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-1,3-thiazol-5-amine (PubChem CID 118944669) has the molecular formula C14H14F3N3O2S and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-methoxy-2-pyridin-3-yl-N-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-1,3-thiazol-5-amine.
| Compound Name | 4-methoxy-2-pyridin-3-yl-N-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 118944669 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-methoxy-2-pyridin-3-yl-N-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-1,3-thiazol-5-amine |
| SMILES | C=C(Nc1sc(-c2cccnc2)nc1OC)OC(C)C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O2S/c1-8(14(15,16)17)22-9(2)19-13-11(21-3)20-12(23-13)10-5-4-6-18-7-10/h4-8,19H,2H2,1,3H3 |
| InChIKey | RZHMCEIQLRNQTG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|