C28H31ClN4O5 — CID 118945559
1-[(4-chlorophenyl)methyl]-3-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]-6-[(2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-1,3,5-triazine-2,4-dione (PubChem CID 118945559) has the molecular formula C28H31ClN4O5 and a molecular weight of 539.03 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]-6-[(2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]-6-[(2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 118945559 |
| Molecular Formula | C28H31ClN4O5 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]-6-[(2-ethyl-3-methyl-1-benzofuran-5-yl)amino]-1,3,5-triazine-2,4-dione |
| SMILES | CCc1oc2ccc(Nc3nc(=O)n(CC4COC(C)(C)OC4)c(=O)n3Cc3ccc(Cl)cc3)cc2c1C |
| InChI | InChI=1S/C28H31ClN4O5/c1-5-23-17(2)22-12-21(10-11-24(22)38-23)30-25-31-26(34)33(14-19-15-36-28(3,4)37-16-19)27(35)32(25)13-18-6-8-20(29)9-7-18/h6-12,19H,5,13-16H2,1-4H3,(H,30,31,34) |
| InChIKey | PZLPJTFPYOYHKF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |