C22H20ClN5O4S2 — CID 118945610
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 118945610) has the molecular formula C22H20ClN5O4S2 and a molecular weight of 518.02 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 118945610 |
| Molecular Formula | C22H20ClN5O4S2 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@H](C)n1c(=O)nc(Nc2ccc3[nH]c(=S)sc3c2)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C22H20ClN5O4S2/c1-11(18(29)30)12(2)28-20(31)26-19(24-15-7-8-16-17(9-15)34-21(33)25-16)27(22(28)32)10-13-3-5-14(23)6-4-13/h3-9,11-12H,10H2,1-2H3,(H,25,33)(H,29,30)(H,24,26,31)/t11-,12+/m1/s1 |
| InChIKey | SPMITOCSMVBJBM-NEPJUHHUSA-N |
| XLogP | 4.40 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|