C22H21FN6O4S — CID 118945655
1-[(4-fluorophenyl)methyl]-3-(3-hydroxypropyl)-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione (PubChem CID 118945655) has the molecular formula C22H21FN6O4S and a molecular weight of 484.51 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(3-hydroxypropyl)-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(3-hydroxypropyl)-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 118945655 |
| Molecular Formula | C22H21FN6O4S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(3-hydroxypropyl)-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione |
| SMILES | Cc1nsc(Oc2ccc(Nc3nc(=O)n(CCCO)c(=O)n3Cc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C22H21FN6O4S/c1-14-24-21(34-27-14)33-18-9-7-17(8-10-18)25-19-26-20(31)28(11-2-12-30)22(32)29(19)13-15-3-5-16(23)6-4-15/h3-10,30H,2,11-13H2,1H3,(H,25,26,31) |
| InChIKey | NSNYPJGODLOVIM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |