About 7-N,4-diethyl-3H-azepine-5,7-diamine
7-N,4-diethyl-3H-azepine-5,7-diamine (PubChem CID 118946189) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 7-N,4-diethyl-3H-azepine-5,7-diamine.
Molecular Properties
| Compound Name | 7-N,4-diethyl-3H-azepine-5,7-diamine |
| PubChem CID | 118946189 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 7-N,4-diethyl-3H-azepine-5,7-diamine |
| SMILES | CCNC1=CC(N)=C(CC)CC=N1 |
| InChI | InChI=1S/C10H17N3/c1-3-8-5-6-13-10(12-4-2)7-9(8)11/h6-7,12H,3-5,11H2,1-2H3 |
| InChIKey | VYGBDJZMMXDLKB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-N,4-diethyl-3H-azepine-5,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N,4-diethyl-3H-azepine-5,7-diamine?
The IUPAC name of 7-N,4-diethyl-3H-azepine-5,7-diamine (CID 118946189) is 7-N,4-diethyl-3H-azepine-5,7-diamine.
What is the SMILES notation for 7-N,4-diethyl-3H-azepine-5,7-diamine?
The canonical SMILES for 7-N,4-diethyl-3H-azepine-5,7-diamine is CCNC1=CC(N)=C(CC)CC=N1.
What is the InChIKey of 7-N,4-diethyl-3H-azepine-5,7-diamine?
The InChIKey is VYGBDJZMMXDLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-3-8-5-6-13-10(12-4-2)7-9(8)11/h6-7,12H,3-5,11H2,1-2H3.
What are the key properties of 7-N,4-diethyl-3H-azepine-5,7-diamine?
7-N,4-diethyl-3H-azepine-5,7-diamine has a molecular weight of 179.27 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N,4-diethyl-3H-azepine-5,7-diamine is sourced from PubChem (CID 118946189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).