C16H19F3N2O3 — CID 11894620
[(3S,3aR,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(5-methylfuran-2-yl)methanone (PubChem CID 11894620) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is [(3S,3aR,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(5-methylfuran-2-yl)methanone.
| Compound Name | [(3S,3aR,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 11894620 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [(3S,3aR,5R)-5-ethyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(5-methylfuran-2-yl)methanone |
| SMILES | CC[C@@H]1CCC2=NN(C(=O)c3ccc(C)o3)[C@@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C16H19F3N2O3/c1-3-10-5-6-12-11(8-10)15(23,16(17,18)19)21(20-12)14(22)13-7-4-9(2)24-13/h4,7,10-11,23H,3,5-6,8H2,1-2H3/t10-,11-,15+/m1/s1 |
| InChIKey | WQOZJUIJBZIIPZ-HFAKWTLXSA-N |
| XLogP | 3.48 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |