C12H16FN — CID 118946207
1-(3-fluorocyclohexa-2,4-dien-1-yl)-2,3,6,7-tetrahydroazepine (PubChem CID 118946207) has the molecular formula C12H16FN and a molecular weight of 193.27 g/mol. Its IUPAC name is 1-(3-fluorocyclohexa-2,4-dien-1-yl)-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-(3-fluorocyclohexa-2,4-dien-1-yl)-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 118946207 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-(3-fluorocyclohexa-2,4-dien-1-yl)-2,3,6,7-tetrahydroazepine |
| SMILES | FC1=CC(N2CCC=CCC2)CC=C1 |
| InChI | InChI=1S/C12H16FN/c13-11-6-5-7-12(10-11)14-8-3-1-2-4-9-14/h1-2,5-6,10,12H,3-4,7-9H2 |
| InChIKey | BUQVOTMUVUJBSE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|