About 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde
2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde (PubChem CID 118946252) has the molecular formula C11H11N3OS
and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde |
| PubChem CID | 118946252 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde |
| SMILES | Nc1nccc(-c2ccc(CC=O)s2)c1N |
| InChI | InChI=1S/C11H11N3OS/c12-10-8(3-5-14-11(10)13)9-2-1-7(16-9)4-6-15/h1-3,5-6H,4,12H2,(H2,13,14) |
| InChIKey | BOSZDZUNCMRMNS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde?
The IUPAC name of 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde (CID 118946252) is 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde.
What is the SMILES notation for 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde?
The canonical SMILES for 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde is Nc1nccc(-c2ccc(CC=O)s2)c1N.
What is the InChIKey of 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde?
The InChIKey is BOSZDZUNCMRMNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3OS/c12-10-8(3-5-14-11(10)13)9-2-1-7(16-9)4-6-15/h1-3,5-6H,4,12H2,(H2,13,14).
What are the key properties of 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde?
2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde has a molecular weight of 233.30 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,3-diamino-4-pyridinyl)thiophen-2-yl]acetaldehyde is sourced from PubChem (CID 118946252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).