C17H28N4O3 — CID 118946387
5-[2-[1-(3-aminopropanoyl)piperidin-4-yl]acetyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 118946387) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 5-[2-[1-(3-aminopropanoyl)piperidin-4-yl]acetyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 5-[2-[1-(3-aminopropanoyl)piperidin-4-yl]acetyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 118946387 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 5-[2-[1-(3-aminopropanoyl)piperidin-4-yl]acetyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | NCCC(=O)N1CCC(CC(=O)N2CCC3NC(=O)CC3C2)CC1 |
| InChI | InChI=1S/C17H28N4O3/c18-5-1-16(23)20-6-2-12(3-7-20)9-17(24)21-8-4-14-13(11-21)10-15(22)19-14/h12-14H,1-11,18H2,(H,19,22) |
| InChIKey | IXKQJNSZPATKQP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |