About tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate
tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate (PubChem CID 118946425) has the molecular formula C17H32N4O4S
and a molecular weight of 388.53 g/mol. Its IUPAC name is tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate |
| PubChem CID | 118946425 |
| Molecular Formula | C17H32N4O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)N2[C@@H]3CC[C@H]2CC(N)C3)CC1 |
| InChI | InChI=1S/C17H32N4O4S/c1-17(2,3)25-16(22)19-13-6-8-20(9-7-13)26(23,24)21-14-4-5-15(21)11-12(18)10-14/h12-15H,4-11,18H2,1-3H3,(H,19,22)/t12?,14-,15+ |
| InChIKey | RZRDFEFMUNCVTJ-LQDVMPOASA-N |
| XLogP | 1.17 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate?
The IUPAC name of tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate (CID 118946425) is tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate is CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)N2[C@@H]3CC[C@H]2CC(N)C3)CC1.
What is the InChIKey of tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate?
The InChIKey is RZRDFEFMUNCVTJ-LQDVMPOASA-N. The full InChI is InChI=1S/C17H32N4O4S/c1-17(2,3)25-16(22)19-13-6-8-20(9-7-13)26(23,24)21-14-4-5-15(21)11-12(18)10-14/h12-15H,4-11,18H2,1-3H3,(H,19,22)/t12?,14-,15+.
What are the key properties of tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate?
tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate has a molecular weight of 388.53 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[[(1R,5S)-3-amino-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]piperidin-4-yl]carbamate is sourced from PubChem (CID 118946425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).