C22H23N3O6 — CID 118947597
2-[4-(2-methoxyethoxy)-6-[(4-methoxyphenyl)methoxy]-3-pyridinyl]-4-methylpyrimidine-5-carboxylic acid (PubChem CID 118947597) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)-6-[(4-methoxyphenyl)methoxy]-3-pyridinyl]-4-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-[4-(2-methoxyethoxy)-6-[(4-methoxyphenyl)methoxy]-3-pyridinyl]-4-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118947597 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)-6-[(4-methoxyphenyl)methoxy]-3-pyridinyl]-4-methylpyrimidine-5-carboxylic acid |
| SMILES | COCCOc1cc(OCc2ccc(OC)cc2)ncc1-c1ncc(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C22H23N3O6/c1-14-17(22(26)27)11-24-21(25-14)18-12-23-20(10-19(18)30-9-8-28-2)31-13-15-4-6-16(29-3)7-5-15/h4-7,10-12H,8-9,13H2,1-3H3,(H,26,27) |
| InChIKey | KBAHVNVNUGIRPU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|