C17H17FN4O — CID 118948681
4-fluoro-N-(1H-indazol-5-yl)-3-methyl-N-pyridin-3-ylbutanamide (PubChem CID 118948681) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-fluoro-N-(1H-indazol-5-yl)-3-methyl-N-pyridin-3-ylbutanamide.
| Compound Name | 4-fluoro-N-(1H-indazol-5-yl)-3-methyl-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 118948681 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-fluoro-N-(1H-indazol-5-yl)-3-methyl-N-pyridin-3-ylbutanamide |
| SMILES | CC(CF)CC(=O)N(c1cccnc1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C17H17FN4O/c1-12(9-18)7-17(23)22(15-3-2-6-19-11-15)14-4-5-16-13(8-14)10-20-21-16/h2-6,8,10-12H,7,9H2,1H3,(H,20,21) |
| InChIKey | KKCQPQPTGGOXNA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |