About 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one
5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one (PubChem CID 118949125) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one.
Molecular Properties
| Compound Name | 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one |
| PubChem CID | 118949125 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one |
| SMILES | CC(=O)C#CC(O)(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C15H24O2/c1-12(16)10-11-15(17,14(2,3)4)13-8-6-5-7-9-13/h13,17H,5-9H2,1-4H3 |
| InChIKey | XATLIQXORZLALW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one?
The IUPAC name of 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one (CID 118949125) is 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one.
What is the SMILES notation for 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one?
The canonical SMILES for 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one is CC(=O)C#CC(O)(C1CCCCC1)C(C)(C)C.
What is the InChIKey of 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one?
The InChIKey is XATLIQXORZLALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-12(16)10-11-15(17,14(2,3)4)13-8-6-5-7-9-13/h13,17H,5-9H2,1-4H3.
What are the key properties of 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one?
5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one has a molecular weight of 236.35 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-5-hydroxy-6,6-dimethylhept-3-yn-2-one is sourced from PubChem (CID 118949125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).