C10H10BrF2NO2 — CID 118949148
5-bromo-3-[3-(difluoromethyl)oxetan-3-yl]-2-methoxypyridine (PubChem CID 118949148) has the molecular formula C10H10BrF2NO2 and a molecular weight of 294.10 g/mol. Its IUPAC name is 5-bromo-3-[3-(difluoromethyl)oxetan-3-yl]-2-methoxypyridine.
| Compound Name | 5-bromo-3-[3-(difluoromethyl)oxetan-3-yl]-2-methoxypyridine |
|---|---|
| PubChem CID | 118949148 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 5-bromo-3-[3-(difluoromethyl)oxetan-3-yl]-2-methoxypyridine |
| SMILES | COc1ncc(Br)cc1C1(C(F)F)COC1 |
| InChI | InChI=1S/C10H10BrF2NO2/c1-15-8-7(2-6(11)3-14-8)10(9(12)13)4-16-5-10/h2-3,9H,4-5H2,1H3 |
| InChIKey | IWTUDHGBPHTDEX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |