C23H19ClF3N5O — CID 118949170
[2-chloro-3-(trifluoromethyl)phenyl]-[(1R,9S)-4-methyl-6-pyrimidin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone (PubChem CID 118949170) has the molecular formula C23H19ClF3N5O and a molecular weight of 473.89 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,9S)-4-methyl-6-pyrimidin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,9S)-4-methyl-6-pyrimidin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
|---|---|
| PubChem CID | 118949170 |
| Molecular Formula | C23H19ClF3N5O |
| Molecular Weight | 473.89 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,9S)-4-methyl-6-pyrimidin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
| SMILES | Cc1nc(-c2ncccn2)c2c(n1)[C@H]1CCC[C@@H](C2)N1C(=O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C23H19ClF3N5O/c1-12-30-19-15(20(31-12)21-28-9-4-10-29-21)11-13-5-2-8-17(19)32(13)22(33)14-6-3-7-16(18(14)24)23(25,26)27/h3-4,6-7,9-10,13,17H,2,5,8,11H2,1H3/t13-,17+/m0/s1 |
| InChIKey | CMIQITWFRNKAPW-SUMWQHHRSA-N |
| XLogP | 5.21 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |