C33H32F3N7O3S — CID 118949730
1-[2-hydroxy-2-(4-nitrophenyl)propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 118949730) has the molecular formula C33H32F3N7O3S and a molecular weight of 663.73 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(4-nitrophenyl)propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 1-[2-hydroxy-2-(4-nitrophenyl)propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 118949730 |
| Molecular Formula | C33H32F3N7O3S |
| Molecular Weight | 663.73 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 1-[2-hydroxy-2-(4-nitrophenyl)propyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CC(C)(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H32F3N7O3S/c1-20-21(3-8-29-27(20)13-25(16-37)42(29)18-32(2,44)22-4-6-24(7-5-22)43(45)46)17-41-11-9-23(10-12-41)40-30-28-14-26(15-33(34,35)36)47-31(28)39-19-38-30/h3-8,13-14,19,23,44H,9-12,15,17-18H2,1-2H3,(H,38,39,40) |
| InChIKey | WJIWJNFSKQFDFX-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|