About 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine
7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 118949734) has the molecular formula C15H13FN8O
and a molecular weight of 340.32 g/mol. Its IUPAC name is 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine |
| PubChem CID | 118949734 |
| Molecular Formula | C15H13FN8O |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Cc1nn(-c2ccc(F)cc2)nc1COc1cc(N)nc2n[nH]nc12 |
| InChI | InChI=1S/C15H13FN8O/c1-8-11(22-24(21-8)10-4-2-9(16)3-5-10)7-25-12-6-13(17)18-15-14(12)19-23-20-15/h2-6H,7H2,1H3,(H3,17,18,19,20,23) |
| InChIKey | RTSNYLJRLUILAH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine?
The IUPAC name of 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine (CID 118949734) is 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine?
The canonical SMILES for 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine is Cc1nn(-c2ccc(F)cc2)nc1COc1cc(N)nc2n[nH]nc12.
What is the InChIKey of 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine?
The InChIKey is RTSNYLJRLUILAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN8O/c1-8-11(22-24(21-8)10-4-2-9(16)3-5-10)7-25-12-6-13(17)18-15-14(12)19-23-20-15/h2-6H,7H2,1H3,(H3,17,18,19,20,23).
What are the key properties of 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine?
7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine has a molecular weight of 340.32 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[2-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 118949734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).