C20H25N3O3P+ — CID 118950554
3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-N-methoxy-N-methylbut-3-enamide (PubChem CID 118950554) has the molecular formula C20H25N3O3P+ and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-N-methoxy-N-methylbut-3-enamide.
| Compound Name | 3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-N-methoxy-N-methylbut-3-enamide |
|---|---|
| PubChem CID | 118950554 |
| Molecular Formula | C20H25N3O3P+ |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-N-methoxy-N-methylbut-3-enamide |
| SMILES | C=C(CC(=O)N(C)OC)[P+]1(O)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C20H25N3O3P/c1-17(16-20(24)21(2)26-3)27(25)22(18-10-6-4-7-11-18)14-15-23(27)19-12-8-5-9-13-19/h4-13,25H,1,14-16H2,2-3H3/q+1 |
| InChIKey | ANQWUOWCEDFNFU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|