About 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one
4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one (PubChem CID 118950571) has the molecular formula C9H12N2O2
and a molecular weight of 187.25 g/mol. Its IUPAC name is 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one |
| PubChem CID | 118950571 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one |
| SMILES | [2H]C(OCC)=C([2H])c1c([2H])nn(C([2H])([2H])[2H])c(=O)c1[2H] |
| InChI | InChI=1S/C9H12N2O2/c1-3-13-5-4-8-6-9(12)11(2)10-7-8/h4-7H,3H2,1-2H3/i2D3,4D,5D,6D,7D |
| InChIKey | IRPGFVJCTTWUOM-HSIAACOPSA-N |
| XLogP | 0.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one?
The IUPAC name of 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one (CID 118950571) is 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one.
What is the SMILES notation for 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one?
The canonical SMILES for 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one is [2H]C(OCC)=C([2H])c1c([2H])nn(C([2H])([2H])[2H])c(=O)c1[2H].
What is the InChIKey of 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one?
The InChIKey is IRPGFVJCTTWUOM-HSIAACOPSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-3-13-5-4-8-6-9(12)11(2)10-7-8/h4-7H,3H2,1-2H3/i2D3,4D,5D,6D,7D.
What are the key properties of 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one?
4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one has a molecular weight of 187.25 g/mol, XLogP of 0.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dideuterio-5-(1,2-dideuterio-2-ethoxyethenyl)-2-(trideuteriomethyl)pyridazin-3-one is sourced from PubChem (CID 118950571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).