C16H19NO2 — CID 118951531
(3R)-2-(2-phenylethyl)-2-azabicyclo[2.2.2]oct-5-ene-3-carboxylic acid (PubChem CID 118951531) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R)-2-(2-phenylethyl)-2-azabicyclo[2.2.2]oct-5-ene-3-carboxylic acid.
| Compound Name | (3R)-2-(2-phenylethyl)-2-azabicyclo[2.2.2]oct-5-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 118951531 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3R)-2-(2-phenylethyl)-2-azabicyclo[2.2.2]oct-5-ene-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1C2C=CC(CC2)N1CCc1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c18-16(19)15-13-6-8-14(9-7-13)17(15)11-10-12-4-2-1-3-5-12/h1-6,8,13-15H,7,9-11H2,(H,18,19)/t13?,14?,15-/m1/s1 |
| InChIKey | NAYPXAFWRVTWCJ-YMAMQOFZSA-N |
| XLogP | 2.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|