About 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid
2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid (PubChem CID 118951724) has the molecular formula C24H19F3O4
and a molecular weight of 428.41 g/mol. Its IUPAC name is 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid |
| PubChem CID | 118951724 |
| Molecular Formula | C24H19F3O4 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid |
| SMILES | O=C(O)COC1CC(c2ccc(-c3cc(Oc4ccc(F)cc4)cc(F)c3F)cc2)C1 |
| InChI | InChI=1S/C24H19F3O4/c25-17-5-7-18(8-6-17)31-20-11-21(24(27)22(26)12-20)15-3-1-14(2-4-15)16-9-19(10-16)30-13-23(28)29/h1-8,11-12,16,19H,9-10,13H2,(H,28,29) |
| InChIKey | WDESOPDWVCGZBA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid?
The IUPAC name of 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid (CID 118951724) is 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid.
What is the SMILES notation for 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid?
The canonical SMILES for 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid is O=C(O)COC1CC(c2ccc(-c3cc(Oc4ccc(F)cc4)cc(F)c3F)cc2)C1.
What is the InChIKey of 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid?
The InChIKey is WDESOPDWVCGZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F3O4/c25-17-5-7-18(8-6-17)31-20-11-21(24(27)22(26)12-20)15-3-1-14(2-4-15)16-9-19(10-16)30-13-23(28)29/h1-8,11-12,16,19H,9-10,13H2,(H,28,29).
What are the key properties of 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid?
2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid has a molecular weight of 428.41 g/mol, XLogP of 5.91, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-[2,3-difluoro-5-(4-fluorophenoxy)phenyl]phenyl]cyclobutyl]oxyacetic acid is sourced from PubChem (CID 118951724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).