About 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole
4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole (PubChem CID 118951977) has the molecular formula C10H13FN2
and a molecular weight of 180.23 g/mol. Its IUPAC name is 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole |
| PubChem CID | 118951977 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole |
| SMILES | C/C=C(\C=C(/C)F)c1cnn(C)c1 |
| InChI | InChI=1S/C10H13FN2/c1-4-9(5-8(2)11)10-6-12-13(3)7-10/h4-7H,1-3H3/b8-5+,9-4+ |
| InChIKey | YVLHGHRLDSMIDG-CCMAPKILSA-N |
| XLogP | 2.70 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole?
The IUPAC name of 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole (CID 118951977) is 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole.
What is the SMILES notation for 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole?
The canonical SMILES for 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole is C/C=C(\C=C(/C)F)c1cnn(C)c1.
What is the InChIKey of 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole?
The InChIKey is YVLHGHRLDSMIDG-CCMAPKILSA-N. The full InChI is InChI=1S/C10H13FN2/c1-4-9(5-8(2)11)10-6-12-13(3)7-10/h4-7H,1-3H3/b8-5+,9-4+.
What are the key properties of 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole?
4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole has a molecular weight of 180.23 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-1-methylpyrazole is sourced from PubChem (CID 118951977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).